Products 1955496-83-9
CAS 1955496-83-9 appears in our catalog under these names: trans,trans-Muconic-d4 Acid, 99 atom % D, min 98% Chemical Purity, D4-trans,trans-Muconic acid, trans-trans-Muconic acid-d4, 99.80%. Offered by: CDN, HPC Standards, MedChemExpress. Available pack sizes: 0,01g, 0,005g, 1x10mg, 1 mg.
(2E,4E)-2,3,4,5-tetradeuteriohexa-2,4-dienedioic acid (CAS 1955496-83-9) is a chemical compound with the molecular formula C6H6O4 and a molecular weight of 146.13 g/mol. IUPAC name: (2E,4E)-2,3,4,5-tetradeuteriohexa-2,4-dienedioic acid. InChIKey: TXXHDPDFNKHHGW-NFCKNUJASA-N.
| Molecular formula | C6H6O4 |
|---|---|
| Molecular weight | 146.13 g/mol |
| IUPAC name | (2E,4E)-2,3,4,5-tetradeuteriohexa-2,4-dienedioic acid |
| InChIKey | TXXHDPDFNKHHGW-NFCKNUJASA-N |
| SMILES | [2H]/C(=C(\C(=O)O)/[2H])/C(=C(/C(=O)O)\[2H])/[2H] |
Computed by PubChem (NCBI)