Products 1185240-24-7
CAS 1185240-24-7 is the registry number for Formetanate-d6, Hydrochloride, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 1mg.
[3-[[bis(trideuteriomethyl)amino]methylideneamino]phenyl] N-methylcarbamate;hydrochloride (CAS 1185240-24-7) is a chemical compound with the molecular formula C11H16ClN3O2 and a molecular weight of 263.75 g/mol. IUPAC name: [3-[[bis(trideuteriomethyl)amino]methylideneamino]phenyl] N-methylcarbamate;hydrochloride. InChIKey: MYPKGPZHHQEODQ-HVTBMTIBSA-N.
| Molecular formula | C11H16ClN3O2 |
|---|---|
| Molecular weight | 263.75 g/mol |
| IUPAC name | [3-[[bis(trideuteriomethyl)amino]methylideneamino]phenyl] N-methylcarbamate;hydrochloride |
| InChIKey | MYPKGPZHHQEODQ-HVTBMTIBSA-N |
| SMILES | [2H]C([2H])([2H])N(C=NC1=CC(=CC=C1)OC(=O)NC)C([2H])([2H])[2H].Cl |
Computed by PubChem (NCBI)