CAS 1286274-86-9 is the registry number for 1-(2-Nitrophenyl)piperidin-4-amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
1-(2-nitrophenyl)piperidin-4-amine;hydrochloride (CAS 1286274-86-9) is a chemical compound with the molecular formula C11H16ClN3O2 and a molecular weight of 257.72 g/mol. IUPAC name: 1-(2-nitrophenyl)piperidin-4-amine;hydrochloride. InChIKey: WKXGCQCWMCCFNH-UHFFFAOYSA-N.
| Molecular formula | C11H16ClN3O2 |
|---|---|
| Molecular weight | 257.72 g/mol |
| IUPAC name | 1-(2-nitrophenyl)piperidin-4-amine;hydrochloride |
| InChIKey | WKXGCQCWMCCFNH-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1N)C2=CC=CC=C2[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)