CAS 1955523-74-6 is the registry number for 6-(1,4-Diazepan-1-yl)pyridine-3-carboxylic acid hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
6-(1,4-diazepan-1-yl)pyridine-3-carboxylic acid;hydrochloride (CAS 1955523-74-6) is a chemical compound with the molecular formula C11H16ClN3O2 and a molecular weight of 257.72 g/mol. IUPAC name: 6-(1,4-diazepan-1-yl)pyridine-3-carboxylic acid;hydrochloride. InChIKey: OVHCFUAAJZKVBO-UHFFFAOYSA-N.
| Molecular formula | C11H16ClN3O2 |
|---|---|
| Molecular weight | 257.72 g/mol |
| IUPAC name | 6-(1,4-diazepan-1-yl)pyridine-3-carboxylic acid;hydrochloride |
| InChIKey | OVHCFUAAJZKVBO-UHFFFAOYSA-N |
| SMILES | C1CNCCN(C1)C2=NC=C(C=C2)C(=O)O.Cl |
Computed by PubChem (NCBI)