CAS 2680772-26-1 is the registry number for tert-Butyl (6-chloro-4,5-dimethylpyridazin-3-yl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-(6-chloro-4,5-dimethylpyridazin-3-yl)carbamate (CAS 2680772-26-1) is a chemical compound with the molecular formula C11H16ClN3O2 and a molecular weight of 257.72 g/mol. IUPAC name: tert-butyl N-(6-chloro-4,5-dimethylpyridazin-3-yl)carbamate. InChIKey: HMSSYAKXRRLIQY-UHFFFAOYSA-N.
| Molecular formula | C11H16ClN3O2 |
|---|---|
| Molecular weight | 257.72 g/mol |
| IUPAC name | tert-butyl N-(6-chloro-4,5-dimethylpyridazin-3-yl)carbamate |
| InChIKey | HMSSYAKXRRLIQY-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN=C1NC(=O)OC(C)(C)C)Cl)C |
Computed by PubChem (NCBI)