CAS 1185299-14-2 is the registry number for 1-[1-(Propan-2-yl)-1h-1,3-benzodiazol-2-yl]ethan-1-amine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
1-(1-propan-2-ylbenzimidazol-2-yl)ethanamine;dihydrochloride (CAS 1185299-14-2) is a chemical compound with the molecular formula C12H19Cl2N3 and a molecular weight of 276.20 g/mol. IUPAC name: 1-(1-propan-2-ylbenzimidazol-2-yl)ethanamine;dihydrochloride. InChIKey: NAHPQLFWXOPEDT-UHFFFAOYSA-N.
| Molecular formula | C12H19Cl2N3 |
|---|---|
| Molecular weight | 276.20 g/mol |
| IUPAC name | 1-(1-propan-2-ylbenzimidazol-2-yl)ethanamine;dihydrochloride |
| InChIKey | NAHPQLFWXOPEDT-UHFFFAOYSA-N |
| SMILES | CC(C)N1C2=CC=CC=C2N=C1C(C)N.Cl.Cl |
Computed by PubChem (NCBI)