CAS 94276-03-6 appears in our catalog under these names: 5-(1H-1,3-Benzodiazol-2-yl)pentan-1-amine dihydrochloride, 95%, 5-(1H-Benzo(d)imidazol-2-yl)pentan-1-amine dihydrochloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
5-(1H-benzimidazol-2-yl)pentan-1-amine;dihydrochloride (CAS 94276-03-6) is a chemical compound with the molecular formula C12H19Cl2N3 and a molecular weight of 276.20 g/mol. IUPAC name: 5-(1H-benzimidazol-2-yl)pentan-1-amine;dihydrochloride. InChIKey: XLRFQSLBBJWMBD-UHFFFAOYSA-N.
| Molecular formula | C12H19Cl2N3 |
|---|---|
| Molecular weight | 276.20 g/mol |
| IUPAC name | 5-(1H-benzimidazol-2-yl)pentan-1-amine;dihydrochloride |
| InChIKey | XLRFQSLBBJWMBD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=N2)CCCCCN.Cl.Cl |
Computed by PubChem (NCBI)