CAS 25810-67-7 appears in our catalog under these names: 1-(1H-Benzo[d]imidazol-2-yl)-3-methylbutan-1-amine dihydrochloride, 95%, 1-(1H-1,3-Benzodiazol-2-yl)-3-methylbutan-1-amine dihydrochloride, 95%, 1-(1H-1,3-Benzodiazol-2-yl)-3-methylbutan-1-amine dihydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 5g, 1g, 100mg.
1-(1H-benzimidazol-2-yl)-3-methylbutan-1-amine;dihydrochloride (CAS 25810-67-7) is a chemical compound with the molecular formula C12H19Cl2N3 and a molecular weight of 276.20 g/mol. IUPAC name: 1-(1H-benzimidazol-2-yl)-3-methylbutan-1-amine;dihydrochloride. InChIKey: BVOUGMCOPRZMAH-UHFFFAOYSA-N.
| Molecular formula | C12H19Cl2N3 |
|---|---|
| Molecular weight | 276.20 g/mol |
| IUPAC name | 1-(1H-benzimidazol-2-yl)-3-methylbutan-1-amine;dihydrochloride |
| InChIKey | BVOUGMCOPRZMAH-UHFFFAOYSA-N |
| SMILES | CC(C)CC(C1=NC2=CC=CC=C2N1)N.Cl.Cl |
Computed by PubChem (NCBI)