CAS 26128-94-9 is the registry number for 1-(1H-1,3-Benzodiazol-2-yl)-2-methylbutan-1-amine dihydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
1-(1H-benzimidazol-2-yl)-2-methylbutan-1-amine;dihydrochloride (CAS 26128-94-9) is a chemical compound with the molecular formula C12H19Cl2N3 and a molecular weight of 276.20 g/mol. IUPAC name: 1-(1H-benzimidazol-2-yl)-2-methylbutan-1-amine;dihydrochloride. InChIKey: LOYFVLXALVSJFL-UHFFFAOYSA-N.
| Molecular formula | C12H19Cl2N3 |
|---|---|
| Molecular weight | 276.20 g/mol |
| IUPAC name | 1-(1H-benzimidazol-2-yl)-2-methylbutan-1-amine;dihydrochloride |
| InChIKey | LOYFVLXALVSJFL-UHFFFAOYSA-N |
| SMILES | CCC(C)C(C1=NC2=CC=CC=C2N1)N.Cl.Cl |
Computed by PubChem (NCBI)