Products 1353293-64-7
CAS 1353293-64-7 is the registry number for (3S)-3-[[(1,1-Dimethylethoxy)carbonyl]amino]hexanedioic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanedioic acid (CAS 1353293-64-7) is a chemical compound with the molecular formula C11H19NO6 and a molecular weight of 261.27 g/mol. IUPAC name: (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanedioic acid. InChIKey: BWZYMMYMEYGJOL-ZETCQYMHSA-N.
| Molecular formula | C11H19NO6 |
|---|---|
| Molecular weight | 261.27 g/mol |
| IUPAC name | (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanedioic acid |
| InChIKey | BWZYMMYMEYGJOL-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCC(=O)O)CC(=O)O |
Computed by PubChem (NCBI)