Products 1185302-49-1

CAS 1185302-49-1 is the registry number for 2-(4-Hydroxypiperidin-1-yl)benzaldehyde hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

2-(4-hydroxypiperidin-1-yl)benzaldehyde;hydrochloride (CAS 1185302-49-1) is a chemical compound with the molecular formula C12H16ClNO2 and a molecular weight of 241.71 g/mol. IUPAC name: 2-(4-hydroxypiperidin-1-yl)benzaldehyde;hydrochloride. InChIKey: DSNMGRMABZDEIQ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H16ClNO2
Molecular weight241.71 g/mol
IUPAC name2-(4-hydroxypiperidin-1-yl)benzaldehyde;hydrochloride
InChIKeyDSNMGRMABZDEIQ-UHFFFAOYSA-N
SMILESC1CN(CCC1O)C2=CC=CC=C2C=O.Cl

Computed by PubChem (NCBI)