CAS 1185306-18-6 is the registry number for 5–(2–Bromophenyl–d4)–2H–tetrazole. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
5-(2-bromo-3,4,5,6-tetradeuteriophenyl)-2H-tetrazole (CAS 1185306-18-6) is a chemical compound with the molecular formula C7H5BrN4 and a molecular weight of 229.07 g/mol. IUPAC name: 5-(2-bromo-3,4,5,6-tetradeuteriophenyl)-2H-tetrazole. InChIKey: YHVBXKTXLJTDRI-RHQRLBAQSA-N.
| Molecular formula | C7H5BrN4 |
|---|---|
| Molecular weight | 229.07 g/mol |
| IUPAC name | 5-(2-bromo-3,4,5,6-tetradeuteriophenyl)-2H-tetrazole |
| InChIKey | YHVBXKTXLJTDRI-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C2=NNN=N2)Br)[2H])[2H] |
Computed by PubChem (NCBI)