CAS 1185306-66-4 is the registry number for 1–Chloro–4–(ethoxy–d5)–phthalazine. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
1-chloro-4-(1,1,2,2,2-pentadeuterioethoxy)phthalazine (CAS 1185306-66-4) is a chemical compound with the molecular formula C10H9ClN2O and a molecular weight of 213.67 g/mol. IUPAC name: 1-chloro-4-(1,1,2,2,2-pentadeuterioethoxy)phthalazine. InChIKey: KQLFVZGMRLYYBY-ZBJDZAJPSA-N.
| Molecular formula | C10H9ClN2O |
|---|---|
| Molecular weight | 213.67 g/mol |
| IUPAC name | 1-chloro-4-(1,1,2,2,2-pentadeuterioethoxy)phthalazine |
| InChIKey | KQLFVZGMRLYYBY-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])OC1=NN=C(C2=CC=CC=C21)Cl |
Computed by PubChem (NCBI)