Products 1185307-27-0
CAS 1185307-27-0 is the registry number for Methyl–d3 3–(methoxy–d3)–bromophenyl–4–carboxylate. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
Trideuteriomethyl 4-bromo-2-(trideuteriomethoxy)benzoate (CAS 1185307-27-0) is a chemical compound with the molecular formula C9H9BrO3 and a molecular weight of 251.11 g/mol. IUPAC name: trideuteriomethyl 4-bromo-2-(trideuteriomethoxy)benzoate. InChIKey: WPGAGRPPDYAZAD-WFGJKAKNSA-N.
| Molecular formula | C9H9BrO3 |
|---|---|
| Molecular weight | 251.11 g/mol |
| IUPAC name | trideuteriomethyl 4-bromo-2-(trideuteriomethoxy)benzoate |
| InChIKey | WPGAGRPPDYAZAD-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C=CC(=C1)Br)C(=O)OC([2H])([2H])[2H] |
Computed by PubChem (NCBI)