CAS 1185311-69-6 is the registry number for 3–Trifluoromethyl–5–(methyl–d3)–bromobenzene. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
1-bromo-3-(trideuteriomethyl)-5-(trifluoromethyl)benzene (CAS 1185311-69-6) is a chemical compound with the molecular formula C8H6BrF3 and a molecular weight of 242.05 g/mol. IUPAC name: 1-bromo-3-(trideuteriomethyl)-5-(trifluoromethyl)benzene. InChIKey: ZDAIYLXHTGIUGY-FIBGUPNXSA-N.
| Molecular formula | C8H6BrF3 |
|---|---|
| Molecular weight | 242.05 g/mol |
| IUPAC name | 1-bromo-3-(trideuteriomethyl)-5-(trifluoromethyl)benzene |
| InChIKey | ZDAIYLXHTGIUGY-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=CC(=CC(=C1)Br)C(F)(F)F |
Computed by PubChem (NCBI)