CAS 1185316-68-0 is the registry number for 2–Chloro–3–trifluoromethyl–6–(n–propyl–d7)–pyridine. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
2-chloro-6-(1,1,2,2,3,3,3-heptadeuteriopropyl)-3-(trifluoromethyl)pyridine (CAS 1185316-68-0) is a chemical compound with the molecular formula C9H9ClF3N and a molecular weight of 230.66 g/mol. IUPAC name: 2-chloro-6-(1,1,2,2,3,3,3-heptadeuteriopropyl)-3-(trifluoromethyl)pyridine. InChIKey: DDMMBXAQBYLMLP-NCKGIQLSSA-N.
| Molecular formula | C9H9ClF3N |
|---|---|
| Molecular weight | 230.66 g/mol |
| IUPAC name | 2-chloro-6-(1,1,2,2,3,3,3-heptadeuteriopropyl)-3-(trifluoromethyl)pyridine |
| InChIKey | DDMMBXAQBYLMLP-NCKGIQLSSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C1=NC(=C(C=C1)C(F)(F)F)Cl |
Computed by PubChem (NCBI)