CAS 1185318-27-7 is the registry number for 4–Chloro–6–(phenyl–d5)–pyrimidine. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
4-chloro-6-(2,3,4,5,6-pentadeuteriophenyl)pyrimidine (CAS 1185318-27-7) is a chemical compound with the molecular formula C10H7ClN2 and a molecular weight of 195.66 g/mol. IUPAC name: 4-chloro-6-(2,3,4,5,6-pentadeuteriophenyl)pyrimidine. InChIKey: RHTJKTOWBBKGNJ-RALIUCGRSA-N.
| Molecular formula | C10H7ClN2 |
|---|---|
| Molecular weight | 195.66 g/mol |
| IUPAC name | 4-chloro-6-(2,3,4,5,6-pentadeuteriophenyl)pyrimidine |
| InChIKey | RHTJKTOWBBKGNJ-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C2=CC(=NC=N2)Cl)[2H])[2H] |
Computed by PubChem (NCBI)