Products 118559-21-0
CAS 118559-21-0 appears in our catalog under these names: 2-Chloro-5-(pentafluoroethyl)pyridine, 95%, 2-Chloro-5-(pentafluoroethyl)pyridine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 0,5g, 50mg.
2-chloro-5-(1,1,2,2,2-pentafluoroethyl)pyridine (CAS 118559-21-0) is a chemical compound with the molecular formula C7H3ClF5N and a molecular weight of 231.55 g/mol. IUPAC name: 2-chloro-5-(1,1,2,2,2-pentafluoroethyl)pyridine. InChIKey: YRBHRYDSCMEMAY-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF5N |
|---|---|
| Molecular weight | 231.55 g/mol |
| IUPAC name | 2-chloro-5-(1,1,2,2,2-pentafluoroethyl)pyridine |
| InChIKey | YRBHRYDSCMEMAY-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C(C(F)(F)F)(F)F)Cl |
Computed by PubChem (NCBI)