Products 1816282-83-3
CAS 1816282-83-3 is the registry number for 5-Chloro-2-(pentafluoroethyl)pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
5-chloro-2-(1,1,2,2,2-pentafluoroethyl)pyridine (CAS 1816282-83-3) is a chemical compound with the molecular formula C7H3ClF5N and a molecular weight of 231.55 g/mol. IUPAC name: 5-chloro-2-(1,1,2,2,2-pentafluoroethyl)pyridine. InChIKey: FQCWRGHASNZSMC-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF5N |
|---|---|
| Molecular weight | 231.55 g/mol |
| IUPAC name | 5-chloro-2-(1,1,2,2,2-pentafluoroethyl)pyridine |
| InChIKey | FQCWRGHASNZSMC-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1Cl)C(C(F)(F)F)(F)F |
Computed by PubChem (NCBI)