Products 1816286-29-9
CAS 1816286-29-9 appears in our catalog under these names: 2-Chloro-4-(pentafluoroethyl)pyridine, 95%, 2-Chloro-4-(pentafluoroethyl)pyridine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 50mg, 0,5g.
2-chloro-4-(1,1,2,2,2-pentafluoroethyl)pyridine (CAS 1816286-29-9) is a chemical compound with the molecular formula C7H3ClF5N and a molecular weight of 231.55 g/mol. IUPAC name: 2-chloro-4-(1,1,2,2,2-pentafluoroethyl)pyridine. InChIKey: CPYPPJNGBTUKNW-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF5N |
|---|---|
| Molecular weight | 231.55 g/mol |
| IUPAC name | 2-chloro-4-(1,1,2,2,2-pentafluoroethyl)pyridine |
| InChIKey | CPYPPJNGBTUKNW-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1C(C(F)(F)F)(F)F)Cl |
Computed by PubChem (NCBI)