CAS 914635-28-2 is the registry number for 6-Chloro-2,3-difluoro-4-(trifluoromethyl)aniline, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-2,3-difluoro-4-(trifluoromethyl)aniline (CAS 914635-28-2) is a chemical compound with the molecular formula C7H3ClF5N and a molecular weight of 231.55 g/mol. IUPAC name: 6-chloro-2,3-difluoro-4-(trifluoromethyl)aniline. InChIKey: SBXZMNBNIFKFNA-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF5N |
|---|---|
| Molecular weight | 231.55 g/mol |
| IUPAC name | 6-chloro-2,3-difluoro-4-(trifluoromethyl)aniline |
| InChIKey | SBXZMNBNIFKFNA-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Cl)N)F)F)C(F)(F)F |
Computed by PubChem (NCBI)