CAS 118591-69-8 is the registry number for 2,6-Difluoro-N-hydroxybenzenecarboximidoyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
(1Z)-2,6-difluoro-N-hydroxybenzenecarboximidoyl chloride (CAS 118591-69-8) is a chemical compound with the molecular formula C7H4ClF2NO and a molecular weight of 191.56 g/mol. IUPAC name: (1Z)-2,6-difluoro-N-hydroxybenzenecarboximidoyl chloride. InChIKey: QBIPVAANFKTSIG-XFFZJAGNSA-N.
| Molecular formula | C7H4ClF2NO |
|---|---|
| Molecular weight | 191.56 g/mol |
| IUPAC name | (1Z)-2,6-difluoro-N-hydroxybenzenecarboximidoyl chloride |
| InChIKey | QBIPVAANFKTSIG-XFFZJAGNSA-N |
| SMILES | C1=CC(=C(C(=C1)F)/C(=N/O)/Cl)F |
Computed by PubChem (NCBI)