CAS 296274-32-3 is the registry number for 2-Chloro-4,5-difluorobenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-chloro-4,5-difluorobenzamide (CAS 296274-32-3) is a chemical compound with the molecular formula C7H4ClF2NO and a molecular weight of 191.56 g/mol. IUPAC name: 2-chloro-4,5-difluorobenzamide. InChIKey: MOEBPPAZJWHWLD-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF2NO |
|---|---|
| Molecular weight | 191.56 g/mol |
| IUPAC name | 2-chloro-4,5-difluorobenzamide |
| InChIKey | MOEBPPAZJWHWLD-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)F)Cl)C(=O)N |
Computed by PubChem (NCBI)