Products 1268605-91-9
CAS 1268605-91-9 is the registry number for (S)-Lisofylline-d5. Offered by: MedChemExpress. Available pack sizes: Get quote.
3,7-dimethyl-1-[(5S)-4,4,6,6,6-pentadeuterio-5-hydroxyhexyl]purine-2,6-dione (CAS 1268605-91-9) is a chemical compound with the molecular formula C13H20N4O3 and a molecular weight of 285.35 g/mol. IUPAC name: 3,7-dimethyl-1-[(5S)-4,4,6,6,6-pentadeuterio-5-hydroxyhexyl]purine-2,6-dione. InChIKey: NSMXQKNUPPXBRG-WHPHVCHMSA-N.
| Molecular formula | C13H20N4O3 |
|---|---|
| Molecular weight | 285.35 g/mol |
| IUPAC name | 3,7-dimethyl-1-[(5S)-4,4,6,6,6-pentadeuterio-5-hydroxyhexyl]purine-2,6-dione |
| InChIKey | NSMXQKNUPPXBRG-WHPHVCHMSA-N |
| SMILES | [2H]C([2H])([2H])[C@@H](C([2H])([2H])CCCN1C(=O)C2=C(N=CN2C)N(C1=O)C)O |
Computed by PubChem (NCBI)