Products 1186648-00-9
CAS 1186648-00-9 appears in our catalog under these names: (3S,4R)-1-(2-Ethoxyethyl)-4-(3-methoxyphenyl)pyrrolidine-3-carboxylic acid, 95%, (3S,4R)-1-(2-Ethoxyethyl)-4-(3-methoxyphenyl)pyrrolidine-3-carboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
(3S,4R)-1-(2-ethoxyethyl)-4-(3-methoxyphenyl)pyrrolidine-3-carboxylic acid (CAS 1186648-00-9) is a chemical compound with the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. IUPAC name: (3S,4R)-1-(2-ethoxyethyl)-4-(3-methoxyphenyl)pyrrolidine-3-carboxylic acid. InChIKey: WRVBSWGDVVJZRD-LSDHHAIUSA-N.
| Molecular formula | C16H23NO4 |
|---|---|
| Molecular weight | 293.36 g/mol |
| IUPAC name | (3S,4R)-1-(2-ethoxyethyl)-4-(3-methoxyphenyl)pyrrolidine-3-carboxylic acid |
| InChIKey | WRVBSWGDVVJZRD-LSDHHAIUSA-N |
| SMILES | CCOCCN1C[C@H]([C@@H](C1)C(=O)O)C2=CC(=CC=C2)OC |
Computed by PubChem (NCBI)