CAS 1187385-98-3 appears in our catalog under these names: 1-(4-Acetylphenyl)-4-bromo-3,5-dimethylpyrazole, 98%, 1-(4-(4-Bromo-3,5-dimethyl-1H-pyrazol-1-yl)phenyl)ethanone, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 100g, 500g, 1g.
1-[4-(4-bromo-3,5-dimethylpyrazol-1-yl)phenyl]ethanone (CAS 1187385-98-3) is a chemical compound with the molecular formula C13H13BrN2O and a molecular weight of 293.16 g/mol. IUPAC name: 1-[4-(4-bromo-3,5-dimethylpyrazol-1-yl)phenyl]ethanone. InChIKey: CZBBKHPUGGSUJX-UHFFFAOYSA-N.
| Molecular formula | C13H13BrN2O |
|---|---|
| Molecular weight | 293.16 g/mol |
| IUPAC name | 1-[4-(4-bromo-3,5-dimethylpyrazol-1-yl)phenyl]ethanone |
| InChIKey | CZBBKHPUGGSUJX-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C2=CC=C(C=C2)C(=O)C)C)Br |
Computed by PubChem (NCBI)