CAS 1231892-25-3 is the registry number for 5-Bromo-2,3,4,9-tetrahydro-1H-carbazole-8-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide (CAS 1231892-25-3) is a chemical compound with the molecular formula C13H13BrN2O and a molecular weight of 293.16 g/mol. IUPAC name: 4-bromo-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide. InChIKey: LFSDXECHOICODC-UHFFFAOYSA-N.
| Molecular formula | C13H13BrN2O |
|---|---|
| Molecular weight | 293.16 g/mol |
| IUPAC name | 4-bromo-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide |
| InChIKey | LFSDXECHOICODC-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C3=C(C=CC(=C3N2)C(=O)N)Br |
Computed by PubChem (NCBI)