CAS 1579511-77-5 is the registry number for 2-(4-Bromophenyl)-1,3-diazaspiro[4.4]non-1-en-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-bromophenyl)-1,3-diazaspiro[4.4]non-1-en-4-one (CAS 1579511-77-5) is a chemical compound with the molecular formula C13H13BrN2O and a molecular weight of 293.16 g/mol. IUPAC name: 2-(4-bromophenyl)-1,3-diazaspiro[4.4]non-1-en-4-one. InChIKey: KHCOEYMMIPLNPT-UHFFFAOYSA-N.
| Molecular formula | C13H13BrN2O |
|---|---|
| Molecular weight | 293.16 g/mol |
| IUPAC name | 2-(4-bromophenyl)-1,3-diazaspiro[4.4]non-1-en-4-one |
| InChIKey | KHCOEYMMIPLNPT-UHFFFAOYSA-N |
| SMILES | C1CCC2(C1)C(=O)NC(=N2)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)