Products 1416336-77-0
CAS 1416336-77-0 is the registry number for 5-Bromo-n1-(4-methoxyphenyl)benzene-1,2-diamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-bromo-2-N-(4-methoxyphenyl)benzene-1,2-diamine (CAS 1416336-77-0) is a chemical compound with the molecular formula C13H13BrN2O and a molecular weight of 293.16 g/mol. IUPAC name: 4-bromo-2-N-(4-methoxyphenyl)benzene-1,2-diamine. InChIKey: JKADIKYBKLUKJW-UHFFFAOYSA-N.
| Molecular formula | C13H13BrN2O |
|---|---|
| Molecular weight | 293.16 g/mol |
| IUPAC name | 4-bromo-2-N-(4-methoxyphenyl)benzene-1,2-diamine |
| InChIKey | JKADIKYBKLUKJW-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)NC2=C(C=CC(=C2)Br)N |
Computed by PubChem (NCBI)