CAS 1187437-00-8 appears in our catalog under these names: 3-tert-Butylbenzene-1-sulfonamide, 3-tert-Butyl benzenesulfonamide, 98%. Offered by: Biosynth, Fluorochem. Available pack sizes: 5g, 0,5g, 50mg, 100mg, 250mg, 500mg, 1g.
3-tert-butylbenzenesulfonamide (CAS 1187437-00-8) is a chemical compound with the molecular formula C10H15NO2S and a molecular weight of 213.30 g/mol. IUPAC name: 3-tert-butylbenzenesulfonamide. InChIKey: JACGHULSRUWRBD-UHFFFAOYSA-N.
| Molecular formula | C10H15NO2S |
|---|---|
| Molecular weight | 213.30 g/mol |
| IUPAC name | 3-tert-butylbenzenesulfonamide |
| InChIKey | JACGHULSRUWRBD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC=C1)S(=O)(=O)N |
Computed by PubChem (NCBI)