CAS 118752-28-6 is the registry number for 2,9-Dimethyl-1,10-phenanthrolin-5-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
2,9-dimethyl-1,10-phenanthrolin-5-amine (CAS 118752-28-6) is a chemical compound with the molecular formula C14H13N3 and a molecular weight of 223.27 g/mol. IUPAC name: 2,9-dimethyl-1,10-phenanthrolin-5-amine. InChIKey: AGSPLEIIRCKYCM-UHFFFAOYSA-N.
| Molecular formula | C14H13N3 |
|---|---|
| Molecular weight | 223.27 g/mol |
| IUPAC name | 2,9-dimethyl-1,10-phenanthrolin-5-amine |
| InChIKey | AGSPLEIIRCKYCM-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C3C(=C(C=C2C=C1)N)C=CC(=N3)C |
Computed by PubChem (NCBI)