Products 1187667-02-2

CAS 1187667-02-2 is the registry number for 9H-Fluoren-9-ylmethyl 2-hydroxy-1,1-dimethylethylcarbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

9H-fluoren-9-ylmethyl N-(1-hydroxy-2-methylpropan-2-yl)carbamate (CAS 1187667-02-2) is a chemical compound with the molecular formula C19H21NO3 and a molecular weight of 311.4 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-(1-hydroxy-2-methylpropan-2-yl)carbamate. InChIKey: OWBRHJFJQVRIRW-UHFFFAOYSA-N.

Identity
Molecular formulaC19H21NO3
Molecular weight311.4 g/mol
IUPAC name9H-fluoren-9-ylmethyl N-(1-hydroxy-2-methylpropan-2-yl)carbamate
InChIKeyOWBRHJFJQVRIRW-UHFFFAOYSA-N
SMILESCC(C)(CO)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13

Computed by PubChem (NCBI)