CAS 324024-00-2 is the registry number for Paroxetine Hydrochloride Anhydrous EP Impurity A,Paroxetine Hydrochloride EP Impurity A,Paroxetine hydrochloride hemihydrate EP Impurity A. Offered by: Chemat Brand. Available pack sizes: on request.
(3S,4R)-3-(1,3-benzodioxol-5-yloxymethyl)-4-phenylpiperidine (CAS 324024-00-2) is a chemical compound with the molecular formula C19H21NO3 and a molecular weight of 311.4 g/mol. IUPAC name: (3S,4R)-3-(1,3-benzodioxol-5-yloxymethyl)-4-phenylpiperidine. InChIKey: VUYNWBMXOQBJAI-RDJZCZTQSA-N.
| Molecular formula | C19H21NO3 |
|---|---|
| Molecular weight | 311.4 g/mol |
| IUPAC name | (3S,4R)-3-(1,3-benzodioxol-5-yloxymethyl)-4-phenylpiperidine |
| InChIKey | VUYNWBMXOQBJAI-RDJZCZTQSA-N |
| SMILES | C1CNC[C@H]([C@@H]1C2=CC=CC=C2)COC3=CC4=C(C=C3)OCO4 |
Computed by PubChem (NCBI)