CAS 52830-65-6 appears in our catalog under these names: 2-[4-(Diethylamino)-2-methylbenzoyl]benzoic acid, 95%, 2–(4–(Diethylamino)–2–methylbenzoyl)benzoic acid, 2-(4-(Diethylamino)-2-methylbenzoyl)benzoic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
2-[4-(diethylamino)-2-methylbenzoyl]benzoic acid (CAS 52830-65-6) is a chemical compound with the molecular formula C19H21NO3 and a molecular weight of 311.4 g/mol. IUPAC name: 2-[4-(diethylamino)-2-methylbenzoyl]benzoic acid. InChIKey: IZHHSJHVOYVIRH-UHFFFAOYSA-N.
| Molecular formula | C19H21NO3 |
|---|---|
| Molecular weight | 311.4 g/mol |
| IUPAC name | 2-[4-(diethylamino)-2-methylbenzoyl]benzoic acid |
| InChIKey | IZHHSJHVOYVIRH-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC(=C(C=C1)C(=O)C2=CC=CC=C2C(=O)O)C |
Computed by PubChem (NCBI)