CAS 1212363-95-5 is the registry number for N-(Diphenylacetyl)-l-valine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(2S)-2-[(2,2-diphenylacetyl)amino]-3-methylbutanoic acid (CAS 1212363-95-5) is a chemical compound with the molecular formula C19H21NO3 and a molecular weight of 311.4 g/mol. IUPAC name: (2S)-2-[(2,2-diphenylacetyl)amino]-3-methylbutanoic acid. InChIKey: FUPWHHXDOFSBKX-KRWDZBQOSA-N.
| Molecular formula | C19H21NO3 |
|---|---|
| Molecular weight | 311.4 g/mol |
| IUPAC name | (2S)-2-[(2,2-diphenylacetyl)amino]-3-methylbutanoic acid |
| InChIKey | FUPWHHXDOFSBKX-KRWDZBQOSA-N |
| SMILES | CC(C)[C@@H](C(=O)O)NC(=O)C(C1=CC=CC=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)