CAS 1187830-53-0 appears in our catalog under these names: 3-(Imidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride, 95%, 3-(Imidazo(2,1-b)thiazol-6-yl)propanoic acid hydrochloride, 95%, 3–(Imidazo(2,1–b)thiazol–6–yl)propanoicacidhydrochloride, 3-(IMIDAZO[2,1-B]THIAZOL-6-YL)PROPANOIC ACID HCL, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 5g, 1g, 10g.
3-imidazo[2,1-b][1,3]thiazol-6-ylpropanoic acid;hydrochloride (CAS 1187830-53-0) is a chemical compound with the molecular formula C8H9ClN2O2S and a molecular weight of 232.69 g/mol. IUPAC name: 3-imidazo[2,1-b][1,3]thiazol-6-ylpropanoic acid;hydrochloride. InChIKey: UJNDEVZWVCCWCH-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O2S |
|---|---|
| Molecular weight | 232.69 g/mol |
| IUPAC name | 3-imidazo[2,1-b][1,3]thiazol-6-ylpropanoic acid;hydrochloride |
| InChIKey | UJNDEVZWVCCWCH-UHFFFAOYSA-N |
| SMILES | C1=CSC2=NC(=CN21)CCC(=O)O.Cl |
Computed by PubChem (NCBI)