Products 332186-46-6
CAS 332186-46-6 is the registry number for 3-(Chloromethyl)-3,4-dihydro-2H-benzo[e][1,2,4]thiadiazine 1,1-dioxide, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(chloromethyl)-3,4-dihydro-2H-1lambda6,2,4-benzothiadiazine 1,1-dioxide (CAS 332186-46-6) is a chemical compound with the molecular formula C8H9ClN2O2S and a molecular weight of 232.69 g/mol. IUPAC name: 3-(chloromethyl)-3,4-dihydro-2H-1lambda6,2,4-benzothiadiazine 1,1-dioxide. InChIKey: JEBMFUGAWHAZDI-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O2S |
|---|---|
| Molecular weight | 232.69 g/mol |
| IUPAC name | 3-(chloromethyl)-3,4-dihydro-2H-1lambda6,2,4-benzothiadiazine 1,1-dioxide |
| InChIKey | JEBMFUGAWHAZDI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(NS2(=O)=O)CCl |
Computed by PubChem (NCBI)