Products 1856272-69-9
CAS 1856272-69-9 is the registry number for 3-(Azetidine-1-sulfonyl)-2-chloropyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-(azetidin-1-ylsulfonyl)-2-chloropyridine (CAS 1856272-69-9) is a chemical compound with the molecular formula C8H9ClN2O2S and a molecular weight of 232.69 g/mol. IUPAC name: 3-(azetidin-1-ylsulfonyl)-2-chloropyridine. InChIKey: BMCZJLXSEHBGRY-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O2S |
|---|---|
| Molecular weight | 232.69 g/mol |
| IUPAC name | 3-(azetidin-1-ylsulfonyl)-2-chloropyridine |
| InChIKey | BMCZJLXSEHBGRY-UHFFFAOYSA-N |
| SMILES | C1CN(C1)S(=O)(=O)C2=C(N=CC=C2)Cl |
Computed by PubChem (NCBI)