CAS 6301-32-2 is the registry number for Ethyl 6-chloro-2-(methylthio)pyrimidine-4-carboxylate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 6-chloro-2-methylsulfanylpyrimidine-4-carboxylate (CAS 6301-32-2) is a chemical compound with the molecular formula C8H9ClN2O2S and a molecular weight of 232.69 g/mol. IUPAC name: ethyl 6-chloro-2-methylsulfanylpyrimidine-4-carboxylate. InChIKey: QXACMWWXHUOJFI-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O2S |
|---|---|
| Molecular weight | 232.69 g/mol |
| IUPAC name | ethyl 6-chloro-2-methylsulfanylpyrimidine-4-carboxylate |
| InChIKey | QXACMWWXHUOJFI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=NC(=N1)SC)Cl |
Computed by PubChem (NCBI)