CAS 1187929-27-6 is the registry number for 2-(6-Methyl-2-(p-tolyl)imidazo[1,2-a]pyridin-3-yl)acetic acid hydrochloride, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
2-[6-methyl-2-(4-methylphenyl)imidazo[1,2-a]pyridin-3-yl]acetic acid;hydrochloride (CAS 1187929-27-6) is a chemical compound with the molecular formula C17H17ClN2O2 and a molecular weight of 316.8 g/mol. IUPAC name: 2-[6-methyl-2-(4-methylphenyl)imidazo[1,2-a]pyridin-3-yl]acetic acid;hydrochloride. InChIKey: OYSGFKJGHCBAGC-UHFFFAOYSA-N.
| Molecular formula | C17H17ClN2O2 |
|---|---|
| Molecular weight | 316.8 g/mol |
| IUPAC name | 2-[6-methyl-2-(4-methylphenyl)imidazo[1,2-a]pyridin-3-yl]acetic acid;hydrochloride |
| InChIKey | OYSGFKJGHCBAGC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=C(N3C=C(C=CC3=N2)C)CC(=O)O.Cl |
Computed by PubChem (NCBI)