CAS 97404-14-3 appears in our catalog under these names: 1-((3-Aminopropyl)amino)anthracene-9,10-dione hydrochloride, 95%, 95%, 1-((3-AMINOPROPYL)AMINO)ANTHRACENE-9,10-DIONE HYDROCHLORIDE, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g.
1-(3-aminopropylamino)anthracene-9,10-dione;hydrochloride (CAS 97404-14-3) is a chemical compound with the molecular formula C17H17ClN2O2 and a molecular weight of 316.8 g/mol. IUPAC name: 1-(3-aminopropylamino)anthracene-9,10-dione;hydrochloride. InChIKey: MXSLXRJZWUIWCV-UHFFFAOYSA-N.
| Molecular formula | C17H17ClN2O2 |
|---|---|
| Molecular weight | 316.8 g/mol |
| IUPAC name | 1-(3-aminopropylamino)anthracene-9,10-dione;hydrochloride |
| InChIKey | MXSLXRJZWUIWCV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(C2=O)C(=CC=C3)NCCCN.Cl |
Computed by PubChem (NCBI)