CAS 1803567-51-2 is the registry number for N-(3-(3-Chlorobenzoyl)pyridin-2-yl)-2,2-dimethylpropanamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
N-[3-(3-chlorobenzoyl)-2-pyridinyl]-2,2-dimethylpropanamide (CAS 1803567-51-2) is a chemical compound with the molecular formula C17H17ClN2O2 and a molecular weight of 316.8 g/mol. IUPAC name: N-[3-(3-chlorobenzoyl)-2-pyridinyl]-2,2-dimethylpropanamide. InChIKey: MYILXZATVAVXLJ-UHFFFAOYSA-N.
| Molecular formula | C17H17ClN2O2 |
|---|---|
| Molecular weight | 316.8 g/mol |
| IUPAC name | N-[3-(3-chlorobenzoyl)-2-pyridinyl]-2,2-dimethylpropanamide |
| InChIKey | MYILXZATVAVXLJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=C(C=CC=N1)C(=O)C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)