Products 176796-46-6
CAS 176796-46-6 appears in our catalog under these names: Diazepam Impurity 3, Diazepam Impurity 10, Diazepam Impurity 9, N-((5-Chloro-2-(methylamino)phenyl)phenylmethylene)glycine Methyl Ester. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
Methyl 2-[[[5-chloro-2-(methylamino)phenyl]-phenylmethylidene]amino]acetate (CAS 176796-46-6) is a chemical compound with the molecular formula C17H17ClN2O2 and a molecular weight of 316.8 g/mol. IUPAC name: methyl 2-[[[5-chloro-2-(methylamino)phenyl]-phenylmethylidene]amino]acetate. InChIKey: RUKFPBKCDWGOLP-UHFFFAOYSA-N.
| Molecular formula | C17H17ClN2O2 |
|---|---|
| Molecular weight | 316.8 g/mol |
| IUPAC name | methyl 2-[[[5-chloro-2-(methylamino)phenyl]-phenylmethylidene]amino]acetate |
| InChIKey | RUKFPBKCDWGOLP-UHFFFAOYSA-N |
| SMILES | CNC1=C(C=C(C=C1)Cl)C(=NCC(=O)OC)C2=CC=CC=C2 |
Computed by PubChem (NCBI)