CAS 1188053-85-1 is the registry number for 6-Bromo-2,4-dichlorobenzo(d)thiazole, 95%. Offered by: AmBeed. Available pack sizes: 1g.
6-bromo-2,4-dichloro-1,3-benzothiazole (CAS 1188053-85-1) is a chemical compound with the molecular formula C7H2BrCl2NS and a molecular weight of 282.97 g/mol. IUPAC name: 6-bromo-2,4-dichloro-1,3-benzothiazole. InChIKey: ZDLQSDKJEMGTPZ-UHFFFAOYSA-N.
| Molecular formula | C7H2BrCl2NS |
|---|---|
| Molecular weight | 282.97 g/mol |
| IUPAC name | 6-bromo-2,4-dichloro-1,3-benzothiazole |
| InChIKey | ZDLQSDKJEMGTPZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1SC(=N2)Cl)Cl)Br |
Computed by PubChem (NCBI)