Products 22134-06-1
CAS 22134-06-1 is the registry number for 5-Bromo-1,3-dichloro-2-isothiocyanatobenzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-1,3-dichloro-2-isothiocyanatobenzene (CAS 22134-06-1) is a chemical compound with the molecular formula C7H2BrCl2NS and a molecular weight of 282.97 g/mol. IUPAC name: 5-bromo-1,3-dichloro-2-isothiocyanatobenzene. InChIKey: PPWVYXXVKVJZLS-UHFFFAOYSA-N.
| Molecular formula | C7H2BrCl2NS |
|---|---|
| Molecular weight | 282.97 g/mol |
| IUPAC name | 5-bromo-1,3-dichloro-2-isothiocyanatobenzene |
| InChIKey | PPWVYXXVKVJZLS-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)N=C=S)Cl)Br |
Computed by PubChem (NCBI)