CAS 412923-49-0 is the registry number for 2-Bromo-4,6-dichlorobenzo[d]thiazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-4,6-dichloro-1,3-benzothiazole (CAS 412923-49-0) is a chemical compound with the molecular formula C7H2BrCl2NS and a molecular weight of 282.97 g/mol. IUPAC name: 2-bromo-4,6-dichloro-1,3-benzothiazole. InChIKey: JOWWHJWZSDCXRX-UHFFFAOYSA-N.
| Molecular formula | C7H2BrCl2NS |
|---|---|
| Molecular weight | 282.97 g/mol |
| IUPAC name | 2-bromo-4,6-dichloro-1,3-benzothiazole |
| InChIKey | JOWWHJWZSDCXRX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1SC(=N2)Br)Cl)Cl |
Computed by PubChem (NCBI)