Products 2476729-53-8
CAS 2476729-53-8 is the registry number for 3-Bromo-5,7-dichlorothieno[3,2-b]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-5,7-dichlorothieno[3,2-b]pyridine (CAS 2476729-53-8) is a chemical compound with the molecular formula C7H2BrCl2NS and a molecular weight of 282.97 g/mol. IUPAC name: 3-bromo-5,7-dichlorothieno[3,2-b]pyridine. InChIKey: JILGVEOWTBLSBW-UHFFFAOYSA-N.
| Molecular formula | C7H2BrCl2NS |
|---|---|
| Molecular weight | 282.97 g/mol |
| IUPAC name | 3-bromo-5,7-dichlorothieno[3,2-b]pyridine |
| InChIKey | JILGVEOWTBLSBW-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(C(=CS2)Br)N=C1Cl)Cl |
Computed by PubChem (NCBI)