CAS 118828-15-2 appears in our catalog under these names: 4-[5-(Trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenol, 95%, 4-(5-(Trifluoromethyl)-1,2,4-oxadiazol-3-yl)phenol, 97%, 4-(5-(Trifluoromethyl)-1,2,4-oxadiazol-3-yl)phenol. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g, 50mg.
4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenol (CAS 118828-15-2) is a chemical compound with the molecular formula C9H5F3N2O2 and a molecular weight of 230.14 g/mol. IUPAC name: 4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenol. InChIKey: DHTGEEMLNWMWLC-UHFFFAOYSA-N.
| Molecular formula | C9H5F3N2O2 |
|---|---|
| Molecular weight | 230.14 g/mol |
| IUPAC name | 4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenol |
| InChIKey | DHTGEEMLNWMWLC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NOC(=N2)C(F)(F)F)O |
Computed by PubChem (NCBI)