CAS 1841435-85-5 appears in our catalog under these names: 2-(4-(Trifluoromethoxy)phenyl)-1,3,4-oxadiazole, 95%, 2-(4-(Trifluoromethoxy)phenyl)-1,3,4-oxadiazole, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
2-[4-(trifluoromethoxy)phenyl]-1,3,4-oxadiazole (CAS 1841435-85-5) is a chemical compound with the molecular formula C9H5F3N2O2 and a molecular weight of 230.14 g/mol. IUPAC name: 2-[4-(trifluoromethoxy)phenyl]-1,3,4-oxadiazole. InChIKey: KRVNOIKFWJNBAO-UHFFFAOYSA-N.
| Molecular formula | C9H5F3N2O2 |
|---|---|
| Molecular weight | 230.14 g/mol |
| IUPAC name | 2-[4-(trifluoromethoxy)phenyl]-1,3,4-oxadiazole |
| InChIKey | KRVNOIKFWJNBAO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN=CO2)OC(F)(F)F |
Computed by PubChem (NCBI)