Products 959236-70-5
CAS 959236-70-5 appears in our catalog under these names: 7-(Trifluoromethyl)-1h-indazole-3-carboxylic acid, 95%, 7-(Trifluoromethyl)-1H-indazole-3-carboxylic acid, 98+%, 7-(Trifluoromethyl)-1H-indazole-3-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 0,5g, 50mg.
7-(trifluoromethyl)-2H-indazole-3-carboxylic acid (CAS 959236-70-5) is a chemical compound with the molecular formula C9H5F3N2O2 and a molecular weight of 230.14 g/mol. IUPAC name: 7-(trifluoromethyl)-2H-indazole-3-carboxylic acid. InChIKey: AAQQEWUHMVGQQX-UHFFFAOYSA-N.
| Molecular formula | C9H5F3N2O2 |
|---|---|
| Molecular weight | 230.14 g/mol |
| IUPAC name | 7-(trifluoromethyl)-2H-indazole-3-carboxylic acid |
| InChIKey | AAQQEWUHMVGQQX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(NN=C2C(=C1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)